C19H22FNO2 — CID 51355450
(4aR,11bS)-6a-fluoro-4,4,11b-trimethyl-3,10-dioxo-4a,5,6,7,8,9-hexahydrocyclohepta[a]naphthalene-2-carbonitrile (PubChem CID 51355450) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is (4aR,11bS)-6a-fluoro-4,4,11b-trimethyl-3,10-dioxo-4a,5,6,7,8,9-hexahydrocyclohepta[a]naphthalene-2-carbonitrile.
| Compound Name | (4aR,11bS)-6a-fluoro-4,4,11b-trimethyl-3,10-dioxo-4a,5,6,7,8,9-hexahydrocyclohepta[a]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 51355450 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (4aR,11bS)-6a-fluoro-4,4,11b-trimethyl-3,10-dioxo-4a,5,6,7,8,9-hexahydrocyclohepta[a]naphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)CCCC3(F)CC[C@@H]12 |
| InChI | InChI=1S/C19H22FNO2/c1-17(2)14-6-8-19(20)7-4-5-13(22)9-15(19)18(14,3)10-12(11-21)16(17)23/h9-10,14H,4-8H2,1-3H3/t14-,18-,19?/m0/s1 |
| InChIKey | XKDPUFFTHFBKPH-ZWSMLAFMSA-N |
| XLogP | 3.85 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |