C18H18ClN3O2S — CID 51355652
[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 51355652) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51355652 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cnc(C#Cc2cccc(Cl)c2)s1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C18H18ClN3O2S/c19-15-3-1-2-14(12-15)4-5-17-20-13-16(25-17)18(24)22-8-6-21(7-9-22)10-11-23/h1-3,12-13,23H,6-11H2 |
| InChIKey | UJHDIAUGDZAPMQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|