About ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate
ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate (PubChem CID 51355719) has the molecular formula C13H10Br2ClNO2S
and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 51355719 |
| Molecular Formula | C13H10Br2ClNO2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 436.85 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br |
| InChI | InChI=1S/C13H10Br2ClNO2S/c1-2-19-13(18)10-9(11(14)15)17-12(20-10)7-3-5-8(16)6-4-7/h3-6,11H,2H2,1H3 |
| InChIKey | MBUTVDOJIITWFB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate (CID 51355719) is ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br.
What is the InChIKey of ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate?
The InChIKey is MBUTVDOJIITWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Br2ClNO2S/c1-2-19-13(18)10-9(11(14)15)17-12(20-10)7-3-5-8(16)6-4-7/h3-6,11H,2H2,1H3.
What are the key properties of ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate?
ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate has a molecular weight of 439.56 g/mol, XLogP of 5.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 51355719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).