C13H10Br2ClNOS2 — CID 51355721
S-ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carbothioate (PubChem CID 51355721) has the molecular formula C13H10Br2ClNOS2 and a molecular weight of 455.62 g/mol. Its IUPAC name is S-ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carbothioate.
| Compound Name | S-ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carbothioate |
|---|---|
| PubChem CID | 51355721 |
| Molecular Formula | C13H10Br2ClNOS2 |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 452.83 |
| IUPAC Name | S-ethyl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carbothioate |
| SMILES | CCSC(=O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br |
| InChI | InChI=1S/C13H10Br2ClNOS2/c1-2-19-13(18)10-9(11(14)15)17-12(20-10)7-3-5-8(16)6-4-7/h3-6,11H,2H2,1H3 |
| InChIKey | RERARLBAXSBBHG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|