C19H16F3IN2O3S — CID 51355931
(5E)-10,11-difluoro-N-(2-fluoro-4-iodophenyl)-2,2-dioxospiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine (PubChem CID 51355931) has the molecular formula C19H16F3IN2O3S and a molecular weight of 536.31 g/mol. Its IUPAC name is (5E)-10,11-difluoro-N-(2-fluoro-4-iodophenyl)-2,2-dioxospiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine.
| Compound Name | (5E)-10,11-difluoro-N-(2-fluoro-4-iodophenyl)-2,2-dioxospiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine |
|---|---|
| PubChem CID | 51355931 |
| Molecular Formula | C19H16F3IN2O3S |
| Molecular Weight | 536.31 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | (5E)-10,11-difluoro-N-(2-fluoro-4-iodophenyl)-2,2-dioxospiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine |
| SMILES | O=S1(=O)Nc2c(cc(F)c(F)c2Nc2ccc(I)cc2F)OC/C=C/CC12CC2 |
| InChI | InChI=1S/C19H16F3IN2O3S/c20-12-9-11(23)3-4-14(12)24-18-16(22)13(21)10-15-17(18)25-29(26,27)19(6-7-19)5-1-2-8-28-15/h1-4,9-10,24-25H,5-8H2/b2-1+ |
| InChIKey | PHTVCTVIMGWHDY-OWOJBTEDSA-N |
| XLogP | 5.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|