C27H22N2O2 — CID 51355989
(4bS,8aR,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-(2-phenylethynyl)-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile (PubChem CID 51355989) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (4bS,8aR,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-(2-phenylethynyl)-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile.
| Compound Name | (4bS,8aR,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-(2-phenylethynyl)-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 51355989 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (4bS,8aR,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-(2-phenylethynyl)-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C(C#N)=C[C@]3(C#Cc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C27H22N2O2/c1-25(2)22-10-12-27(11-9-18-7-5-4-6-8-18)15-19(16-28)21(30)13-23(27)26(22,3)14-20(17-29)24(25)31/h4-8,13-15,22H,10,12H2,1-3H3/t22-,26-,27-/m0/s1 |
| InChIKey | RKJKJPUGMGMUNC-CAVYSCNFSA-N |
| XLogP | 4.46 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|