C8H17NO3 — CID 51356190
(3R,4R,5S)-5-(2-hydroxypropan-2-yl)piperidine-3,4-diol (PubChem CID 51356190) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (3R,4R,5S)-5-(2-hydroxypropan-2-yl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-(2-hydroxypropan-2-yl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 51356190 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3R,4R,5S)-5-(2-hydroxypropan-2-yl)piperidine-3,4-diol |
| SMILES | CC(C)(O)[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO3/c1-8(2,12)5-3-9-4-6(10)7(5)11/h5-7,9-12H,3-4H2,1-2H3/t5-,6+,7+/m0/s1 |
| InChIKey | PVGDVTWSNAIFDH-RRKCRQDMSA-N |
| XLogP | -1.30 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |