About 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one
7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one (PubChem CID 51356252) has the molecular formula C19H12F2N2O3
and a molecular weight of 354.31 g/mol. Its IUPAC name is 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one.
Molecular Properties
| Compound Name | 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one |
| PubChem CID | 51356252 |
| Molecular Formula | C19H12F2N2O3 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one |
| SMILES | O=c1cc(Cn2ccnc2)c2ccc(Oc3ccc(F)c(F)c3)cc2o1 |
| InChI | InChI=1S/C19H12F2N2O3/c20-16-4-2-13(8-17(16)21)25-14-1-3-15-12(10-23-6-5-22-11-23)7-19(24)26-18(15)9-14/h1-9,11H,10H2 |
| InChIKey | HUXMMWKRIINTDW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one?
The IUPAC name of 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one (CID 51356252) is 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one.
What is the SMILES notation for 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one?
The canonical SMILES for 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one is O=c1cc(Cn2ccnc2)c2ccc(Oc3ccc(F)c(F)c3)cc2o1.
What is the InChIKey of 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one?
The InChIKey is HUXMMWKRIINTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O3/c20-16-4-2-13(8-17(16)21)25-14-1-3-15-12(10-23-6-5-22-11-23)7-19(24)26-18(15)9-14/h1-9,11H,10H2.
What are the key properties of 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one?
7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one has a molecular weight of 354.31 g/mol, XLogP of 4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-difluorophenoxy)-4-(imidazol-1-ylmethyl)chromen-2-one is sourced from PubChem (CID 51356252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).