C22H29N3OS — CID 51356294
(1R,12R,13R)-20-[[(2S)-oxolan-2-yl]methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine (PubChem CID 51356294) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is (1R,12R,13R)-20-[[(2S)-oxolan-2-yl]methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine.
| Compound Name | (1R,12R,13R)-20-[[(2S)-oxolan-2-yl]methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
|---|---|
| PubChem CID | 51356294 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (1R,12R,13R)-20-[[(2S)-oxolan-2-yl]methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
| SMILES | Nc1nc2cc3c(cc2s1)C[C@@H]1[C@@H]2CCCC[C@]32CCN1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H29N3OS/c23-21-24-18-12-17-14(11-20(18)27-21)10-19-16-5-1-2-6-22(16,17)7-8-25(19)13-15-4-3-9-26-15/h11-12,15-16,19H,1-10,13H2,(H2,23,24)/t15-,16-,19+,22+/m0/s1 |
| InChIKey | NSXJCOLJLZPHDA-MMQADKFZSA-N |
| XLogP | 4.12 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |