C23H28F3N3S — CID 51356295
(1R,12R,13R)-20-(cyclopropylmethyl)-N-(2,2,2-trifluoroethyl)-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine (PubChem CID 51356295) has the molecular formula C23H28F3N3S and a molecular weight of 435.56 g/mol. Its IUPAC name is (1R,12R,13R)-20-(cyclopropylmethyl)-N-(2,2,2-trifluoroethyl)-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine.
| Compound Name | (1R,12R,13R)-20-(cyclopropylmethyl)-N-(2,2,2-trifluoroethyl)-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
|---|---|
| PubChem CID | 51356295 |
| Molecular Formula | C23H28F3N3S |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (1R,12R,13R)-20-(cyclopropylmethyl)-N-(2,2,2-trifluoroethyl)-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
| SMILES | FC(F)(F)CNc1nc2cc3c(cc2s1)C[C@@H]1[C@@H]2CCCC[C@]32CCN1CC1CC1 |
| InChI | InChI=1S/C23H28F3N3S/c24-23(25,26)13-27-21-28-18-11-17-15(10-20(18)30-21)9-19-16-3-1-2-6-22(16,17)7-8-29(19)12-14-4-5-14/h10-11,14,16,19H,1-9,12-13H2,(H,27,28)/t16-,19+,22+/m0/s1 |
| InChIKey | TWQQFRJQSQBQAP-DKZVUGQWSA-N |
| XLogP | 5.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |