C29H35N3OS — CID 51356296
(1R,12R,13R)-20-(cyclopropylmethyl)-N-[(3-methoxyphenyl)methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine (PubChem CID 51356296) has the molecular formula C29H35N3OS and a molecular weight of 473.69 g/mol. Its IUPAC name is (1R,12R,13R)-20-(cyclopropylmethyl)-N-[(3-methoxyphenyl)methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine.
| Compound Name | (1R,12R,13R)-20-(cyclopropylmethyl)-N-[(3-methoxyphenyl)methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
|---|---|
| PubChem CID | 51356296 |
| Molecular Formula | C29H35N3OS |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (1R,12R,13R)-20-(cyclopropylmethyl)-N-[(3-methoxyphenyl)methyl]-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-amine |
| SMILES | COc1cccc(CNc2nc3cc4c(cc3s2)C[C@@H]2[C@@H]3CCCC[C@]43CCN2CC2CC2)c1 |
| InChI | InChI=1S/C29H35N3OS/c1-33-22-6-4-5-20(13-22)17-30-28-31-25-16-24-21(15-27(25)34-28)14-26-23-7-2-3-10-29(23,24)11-12-32(26)18-19-8-9-19/h4-6,13,15-16,19,23,26H,2-3,7-12,14,17-18H2,1H3,(H,30,31)/t23-,26+,29+/m0/s1 |
| InChIKey | OSVAZEJQBRMPNR-SCWLSEGGSA-N |
| XLogP | 6.39 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |