About (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide
(E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide (PubChem CID 51356438) has the molecular formula C17H18N2O5
and a molecular weight of 330.34 g/mol. Its IUPAC name is (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide |
| PubChem CID | 51356438 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide |
| SMILES | CC(=O)N1CCC2(CC(=O)c3cc(/C=C/C(=O)NO)ccc3O2)C1 |
| InChI | InChI=1S/C17H18N2O5/c1-11(20)19-7-6-17(10-19)9-14(21)13-8-12(2-4-15(13)24-17)3-5-16(22)18-23/h2-5,8,23H,6-7,9-10H2,1H3,(H,18,22)/b5-3+ |
| InChIKey | XDGUIBAHCFBPDB-HWKANZROSA-N |
| XLogP | 1.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide (CID 51356438) is (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide is CC(=O)N1CCC2(CC(=O)c3cc(/C=C/C(=O)NO)ccc3O2)C1.
What is the InChIKey of (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The InChIKey is XDGUIBAHCFBPDB-HWKANZROSA-N. The full InChI is InChI=1S/C17H18N2O5/c1-11(20)19-7-6-17(10-19)9-14(21)13-8-12(2-4-15(13)24-17)3-5-16(22)18-23/h2-5,8,23H,6-7,9-10H2,1H3,(H,18,22)/b5-3+.
What are the key properties of (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
(E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide has a molecular weight of 330.34 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide is sourced from PubChem (CID 51356438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).