C10H19F2NO2 — CID 51356490
(3R,4R,5S)-1-butyl-5-(difluoromethyl)piperidine-3,4-diol (PubChem CID 51356490) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is (3R,4R,5S)-1-butyl-5-(difluoromethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-1-butyl-5-(difluoromethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 51356490 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3R,4R,5S)-1-butyl-5-(difluoromethyl)piperidine-3,4-diol |
| SMILES | CCCCN1C[C@@H](O)[C@H](O)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C10H19F2NO2/c1-2-3-4-13-5-7(10(11)12)9(15)8(14)6-13/h7-10,14-15H,2-6H2,1H3/t7-,8+,9+/m0/s1 |
| InChIKey | VKDRELSVZAHLFA-DJLDLDEBSA-N |
| XLogP | 0.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |