C30H46N2O3Si — CID 51356575
2-[[2-[2-[(4'aS,8'aR,10'aR)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]ethynyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 51356575) has the molecular formula C30H46N2O3Si and a molecular weight of 510.80 g/mol. Its IUPAC name is 2-[[2-[2-[(4'aS,8'aR,10'aR)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]ethynyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[2-[(4'aS,8'aR,10'aR)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]ethynyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 51356575 |
| Molecular Formula | C30H46N2O3Si |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 2-[[2-[2-[(4'aS,8'aR,10'aR)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]ethynyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)[C@@H]2CC[C@@]3(C#Cc4nccn4COCC[Si](C)(C)C)CCCC=C3[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C30H46N2O3Si/c1-27(2)24-10-13-29(14-11-26-31-17-18-32(26)23-33-21-22-36(4,5)6)12-8-7-9-25(29)28(24,3)15-16-30(27)34-19-20-35-30/h9,17-18,24H,7-8,10,12-13,15-16,19-23H2,1-6H3/t24-,28-,29+/m0/s1 |
| InChIKey | LJZHGLZEJMUCLY-RVVSJWLRSA-N |
| XLogP | 6.62 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|