C31H47N3O8S — CID 51356682
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;7-[[(2R,3R,4R,6S)-2,3,4,6,7-pentahydroxyheptanoyl]amino]heptanoic acid (PubChem CID 51356682) has the molecular formula C31H47N3O8S and a molecular weight of 621.80 g/mol. Its IUPAC name is N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;7-[[(2R,3R,4R,6S)-2,3,4,6,7-pentahydroxyheptanoyl]amino]heptanoic acid.
| Compound Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;7-[[(2R,3R,4R,6S)-2,3,4,6,7-pentahydroxyheptanoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 51356682 |
| Molecular Formula | C31H47N3O8S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;7-[[(2R,3R,4R,6S)-2,3,4,6,7-pentahydroxyheptanoyl]amino]heptanoic acid |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C.O=C(O)CCCCCCNC(=O)[C@H](O)[C@H](O)[C@H](O)C[C@H](O)CO |
| InChI | InChI=1S/C17H20N2S.C14H27NO8/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;16-8-9(17)7-10(18)12(21)13(22)14(23)15-6-4-2-1-3-5-11(19)20/h4-11,13H,12H2,1-3H3;9-10,12-13,16-18,21-22H,1-8H2,(H,15,23)(H,19,20)/t;9-,10+,12+,13+/m.0/s1 |
| InChIKey | QJBXQMQGVUOJFN-ICDHFMRESA-N |
| XLogP | 2.20 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|