C25H26FN5O4 — CID 51356719
17-fluoro-9-hydroxy-20-oxa-1,7,12,26,31-pentazapentacyclo[24.2.2.12,10.03,8.014,19]hentriaconta-2(31),3(8),4,6,9,14(19),15,17-octaene-11,25-dione (PubChem CID 51356719) has the molecular formula C25H26FN5O4 and a molecular weight of 479.51 g/mol. Its IUPAC name is 17-fluoro-9-hydroxy-20-oxa-1,7,12,26,31-pentazapentacyclo[24.2.2.12,10.03,8.014,19]hentriaconta-2(31),3(8),4,6,9,14(19),15,17-octaene-11,25-dione.
| Compound Name | 17-fluoro-9-hydroxy-20-oxa-1,7,12,26,31-pentazapentacyclo[24.2.2.12,10.03,8.014,19]hentriaconta-2(31),3(8),4,6,9,14(19),15,17-octaene-11,25-dione |
|---|---|
| PubChem CID | 51356719 |
| Molecular Formula | C25H26FN5O4 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 17-fluoro-9-hydroxy-20-oxa-1,7,12,26,31-pentazapentacyclo[24.2.2.12,10.03,8.014,19]hentriaconta-2(31),3(8),4,6,9,14(19),15,17-octaene-11,25-dione |
| SMILES | O=C1NCc2ccc(F)cc2OCCCCC(=O)N2CCN(CC2)c2nc1c(O)c1ncccc21 |
| InChI | InChI=1S/C25H26FN5O4/c26-17-7-6-16-15-28-25(34)22-23(33)21-18(4-3-8-27-21)24(29-22)31-11-9-30(10-12-31)20(32)5-1-2-13-35-19(16)14-17/h3-4,6-8,14,33H,1-2,5,9-13,15H2,(H,28,34) |
| InChIKey | DKHHQXQSYABQJL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |