C9H15F2NO2 — CID 51356753
(3R,4R,5S)-5-(difluoromethyl)-1-prop-2-enylpiperidine-3,4-diol (PubChem CID 51356753) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is (3R,4R,5S)-5-(difluoromethyl)-1-prop-2-enylpiperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-(difluoromethyl)-1-prop-2-enylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 51356753 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (3R,4R,5S)-5-(difluoromethyl)-1-prop-2-enylpiperidine-3,4-diol |
| SMILES | C=CCN1C[C@@H](O)[C@H](O)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C9H15F2NO2/c1-2-3-12-4-6(9(10)11)8(14)7(13)5-12/h2,6-9,13-14H,1,3-5H2/t6-,7+,8+/m0/s1 |
| InChIKey | KVTQNJLVDOTKRW-XLPZGREQSA-N |
| XLogP | 0.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|