About (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid
(E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid (PubChem CID 51356794) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid.
Molecular Properties
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid |
| PubChem CID | 51356794 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid |
| SMILES | CC(C)(/C=C/CO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H26O3Si/c1-12(2,3)17(6,7)16-10-8-9-13(4,5)11(14)15/h8-9H,10H2,1-7H3,(H,14,15)/b9-8+ |
| InChIKey | AVHNGNFNNSODJI-CMDGGOBGSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid?
The IUPAC name of (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid (CID 51356794) is (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid.
What is the SMILES notation for (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid?
The canonical SMILES for (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid is CC(C)(/C=C/CO[Si](C)(C)C(C)(C)C)C(=O)O.
What is the InChIKey of (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid?
The InChIKey is AVHNGNFNNSODJI-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-12(2,3)17(6,7)16-10-8-9-13(4,5)11(14)15/h8-9H,10H2,1-7H3,(H,14,15)/b9-8+.
What are the key properties of (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid?
(E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid has a molecular weight of 258.43 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpent-3-enoic acid is sourced from PubChem (CID 51356794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).