About 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 51356806) has the molecular formula C19H19F3N4O
and a molecular weight of 376.38 g/mol. Its IUPAC name is 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 51356806 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(CN2CCCCC2)nc2c(-c3ccccc3)c(C(F)(F)F)[nH]n12 |
| InChI | InChI=1S/C19H19F3N4O/c20-19(21,22)17-16(13-7-3-1-4-8-13)18-23-14(11-15(27)26(18)24-17)12-25-9-5-2-6-10-25/h1,3-4,7-8,11,24H,2,5-6,9-10,12H2 |
| InChIKey | UDIMNJPEOGWWIY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 51356806) is 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(CN2CCCCC2)nc2c(-c3ccccc3)c(C(F)(F)F)[nH]n12.
What is the InChIKey of 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is UDIMNJPEOGWWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F3N4O/c20-19(21,22)17-16(13-7-3-1-4-8-13)18-23-14(11-15(27)26(18)24-17)12-25-9-5-2-6-10-25/h1,3-4,7-8,11,24H,2,5-6,9-10,12H2.
What are the key properties of 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 376.38 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-(piperidin-1-ylmethyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 51356806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).