C11H20F2N2O2S — CID 51357034
(3S,4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carbothioamide (PubChem CID 51357034) has the molecular formula C11H20F2N2O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is (3S,4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carbothioamide.
| Compound Name | (3S,4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 51357034 |
| Molecular Formula | C11H20F2N2O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (3S,4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1C[C@@H](O)[C@H](O)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C11H20F2N2O2S/c1-2-3-4-14-11(18)15-5-7(10(12)13)9(17)8(16)6-15/h7-10,16-17H,2-6H2,1H3,(H,14,18)/t7-,8+,9+/m0/s1 |
| InChIKey | IQRQGBLPMUDDBH-DJLDLDEBSA-N |
| XLogP | 0.58 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|