C14H8Cl2F3N3O — CID 51357085
5-(chloromethyl)-3-(4-chlorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 51357085) has the molecular formula C14H8Cl2F3N3O and a molecular weight of 362.14 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(4-chlorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(chloromethyl)-3-(4-chlorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 51357085 |
| Molecular Formula | C14H8Cl2F3N3O |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 5-(chloromethyl)-3-(4-chlorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(CCl)nc2c(-c3ccc(Cl)cc3)c(C(F)(F)F)[nH]n12 |
| InChI | InChI=1S/C14H8Cl2F3N3O/c15-6-9-5-10(23)22-13(20-9)11(12(21-22)14(17,18)19)7-1-3-8(16)4-2-7/h1-5,21H,6H2 |
| InChIKey | QZAOPTPIUYQMMK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|