C19H8F7N3O — CID 51357088
3-phenyl-5-(2,3,4,5-tetrafluorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 51357088) has the molecular formula C19H8F7N3O and a molecular weight of 427.28 g/mol. Its IUPAC name is 3-phenyl-5-(2,3,4,5-tetrafluorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-phenyl-5-(2,3,4,5-tetrafluorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 51357088 |
| Molecular Formula | C19H8F7N3O |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-phenyl-5-(2,3,4,5-tetrafluorophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2cc(F)c(F)c(F)c2F)nc2c(-c3ccccc3)c(C(F)(F)F)[nH]n12 |
| InChI | InChI=1S/C19H8F7N3O/c20-10-6-9(14(21)16(23)15(10)22)11-7-12(30)29-18(27-11)13(8-4-2-1-3-5-8)17(28-29)19(24,25)26/h1-7,28H |
| InChIKey | LFKRCFSRIIHXRX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|