C17H34O6Si — CID 51357193
[(3aR,5R,6R,6aR)-6-methoxy-5-(methoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 51357193) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-6-methoxy-5-(methoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,5R,6R,6aR)-6-methoxy-5-(methoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 51357193 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(3aR,5R,6R,6aR)-6-methoxy-5-(methoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COC[C@]1(CO[Si](C)(C)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C17H34O6Si/c1-15(2,3)24(8,9)20-11-17(10-18-6)13(19-7)12-14(23-17)22-16(4,5)21-12/h12-14H,10-11H2,1-9H3/t12-,13-,14+,17-/m1/s1 |
| InChIKey | TYQGAAYAQWNOMS-VWPFQQQWSA-N |
| XLogP | 2.92 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|