C13H18N2O5 — CID 51357315
(3R,4R,5R)-5-(hydroxymethyl)-1-[(3-nitrophenyl)methyl]piperidine-3,4-diol (PubChem CID 51357315) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3R,4R,5R)-5-(hydroxymethyl)-1-[(3-nitrophenyl)methyl]piperidine-3,4-diol.
| Compound Name | (3R,4R,5R)-5-(hydroxymethyl)-1-[(3-nitrophenyl)methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 51357315 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (3R,4R,5R)-5-(hydroxymethyl)-1-[(3-nitrophenyl)methyl]piperidine-3,4-diol |
| SMILES | O=[N+]([O-])c1cccc(CN2C[C@H](CO)[C@@H](O)[C@H](O)C2)c1 |
| InChI | InChI=1S/C13H18N2O5/c16-8-10-6-14(7-12(17)13(10)18)5-9-2-1-3-11(4-9)15(19)20/h1-4,10,12-13,16-18H,5-8H2/t10-,12-,13-/m1/s1 |
| InChIKey | WHMRDJICTIWMPM-RAIGVLPGSA-N |
| XLogP | -0.26 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|