C20H17Cl2NOS — CID 51357323
(4R,6R)-3,6-bis(4-chlorophenyl)-4-thiophen-2-yl-1,3-oxazinane (PubChem CID 51357323) has the molecular formula C20H17Cl2NOS and a molecular weight of 390.34 g/mol. Its IUPAC name is (4R,6R)-3,6-bis(4-chlorophenyl)-4-thiophen-2-yl-1,3-oxazinane.
| Compound Name | (4R,6R)-3,6-bis(4-chlorophenyl)-4-thiophen-2-yl-1,3-oxazinane |
|---|---|
| PubChem CID | 51357323 |
| Molecular Formula | C20H17Cl2NOS |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | (4R,6R)-3,6-bis(4-chlorophenyl)-4-thiophen-2-yl-1,3-oxazinane |
| SMILES | Clc1ccc([C@H]2C[C@H](c3cccs3)N(c3ccc(Cl)cc3)CO2)cc1 |
| InChI | InChI=1S/C20H17Cl2NOS/c21-15-5-3-14(4-6-15)19-12-18(20-2-1-11-25-20)23(13-24-19)17-9-7-16(22)8-10-17/h1-11,18-19H,12-13H2/t18-,19-/m1/s1 |
| InChIKey | SQHYCTSXFBMOBD-RTBURBONSA-N |
| XLogP | 6.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |