C19H8ClF6N3O — CID 51357367
3-(4-chlorophenyl)-2-(trifluoromethyl)-5-(2,4,5-trifluorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 51357367) has the molecular formula C19H8ClF6N3O and a molecular weight of 443.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(trifluoromethyl)-5-(2,4,5-trifluorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-(4-chlorophenyl)-2-(trifluoromethyl)-5-(2,4,5-trifluorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 51357367 |
| Molecular Formula | C19H8ClF6N3O |
| Molecular Weight | 443.73 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(trifluoromethyl)-5-(2,4,5-trifluorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2cc(F)c(F)cc2F)nc2c(-c3ccc(Cl)cc3)c(C(F)(F)F)[nH]n12 |
| InChI | InChI=1S/C19H8ClF6N3O/c20-9-3-1-8(2-4-9)16-17(19(24,25)26)28-29-15(30)7-14(27-18(16)29)10-5-12(22)13(23)6-11(10)21/h1-7,28H |
| InChIKey | OPTCWDOIBQGLCZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|