C11H21NO — CID 51357775
(3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-amine (PubChem CID 51357775) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-amine.
| Compound Name | (3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 51357775 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-amine |
| SMILES | C=C/C=C(/OCC)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C11H21NO/c1-6-8-9(13-7-2)10(12)11(3,4)5/h6,8,10H,1,7,12H2,2-5H3/b9-8+/t10-/m1/s1 |
| InChIKey | MMYQYKNKEXLDIF-AAXQSMANSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|