C12H17N7O2S — CID 51358131
2-(3,5-dimethylpiperazin-1-yl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole (PubChem CID 51358131) has the molecular formula C12H17N7O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperazin-1-yl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(3,5-dimethylpiperazin-1-yl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 51358131 |
| Molecular Formula | C12H17N7O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-(3,5-dimethylpiperazin-1-yl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
| SMILES | CC1CN(c2nnc(-c3ncc([N+](=O)[O-])n3C)s2)CC(C)N1 |
| InChI | InChI=1S/C12H17N7O2S/c1-7-5-18(6-8(2)14-7)12-16-15-11(22-12)10-13-4-9(17(10)3)19(20)21/h4,7-8,14H,5-6H2,1-3H3 |
| InChIKey | IANDGHDIENPYAD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|