About 4-ethylpiperidin-4-ol;hydrochloride
4-ethylpiperidin-4-ol;hydrochloride (PubChem CID 51358292) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is 4-ethylpiperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-ethylpiperidin-4-ol;hydrochloride |
| PubChem CID | 51358292 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-ethylpiperidin-4-ol;hydrochloride |
| SMILES | CCC1(O)CCNCC1.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-2-7(9)3-5-8-6-4-7;/h8-9H,2-6H2,1H3;1H |
| InChIKey | RMTPVYXPYUPQDP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylpiperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpiperidin-4-ol;hydrochloride?
The IUPAC name of 4-ethylpiperidin-4-ol;hydrochloride (CID 51358292) is 4-ethylpiperidin-4-ol;hydrochloride.
What is the SMILES notation for 4-ethylpiperidin-4-ol;hydrochloride?
The canonical SMILES for 4-ethylpiperidin-4-ol;hydrochloride is CCC1(O)CCNCC1.Cl.
What is the InChIKey of 4-ethylpiperidin-4-ol;hydrochloride?
The InChIKey is RMTPVYXPYUPQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c1-2-7(9)3-5-8-6-4-7;/h8-9H,2-6H2,1H3;1H.
What are the key properties of 4-ethylpiperidin-4-ol;hydrochloride?
4-ethylpiperidin-4-ol;hydrochloride has a molecular weight of 165.66 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpiperidin-4-ol;hydrochloride is sourced from PubChem (CID 51358292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).