C20H23N3O2S — CID 5135847
ethyl 2-(benzylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 5135847) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is ethyl 2-(benzylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(benzylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 5135847 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 2-(benzylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1NC(=S)NCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C20H23N3O2S/c1-2-25-19(24)16-12-15-10-6-7-11-17(15)22-18(16)23-20(26)21-13-14-8-4-3-5-9-14/h3-5,8-9,12H,2,6-7,10-11,13H2,1H3,(H2,21,22,23,26) |
| InChIKey | MFTHXNCEXZHZIC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|