C10H17NO3 — CID 51358492
ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate (PubChem CID 51358492) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate.
| Compound Name | ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 51358492 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(C)CC(C)C1=O |
| InChI | InChI=1S/C10H17NO3/c1-4-14-10(13)8-6-11(3)5-7(2)9(8)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | OUNDNHXKTOGOSM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|