ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate

C10H17NO3 — CID 51358492

IUPACethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate
SMILESCCOC(=O)C1CN(C)CC(C)C1=O
InChIInChI=1S/C10H17NO3/c1-4-14-10(13)8-6-11(3)5-7(2)9(8)12/h7-8H,4-6H2,1-3H3
InChIKeyOUNDNHXKTOGOSM-UHFFFAOYSA-N
MW199.25 g/mol
LogP0.32
Rot. Bonds2

About ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate

ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate (PubChem CID 51358492) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate.

Molecular Properties

Compound Nameethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate
PubChem CID51358492
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Nameethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate
SMILESCCOC(=O)C1CN(C)CC(C)C1=O
InChIInChI=1S/C10H17NO3/c1-4-14-10(13)8-6-11(3)5-7(2)9(8)12/h7-8H,4-6H2,1-3H3
InChIKeyOUNDNHXKTOGOSM-UHFFFAOYSA-N
XLogP0.32
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 50.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate?
The IUPAC name of ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate (CID 51358492) is ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate.
What is the SMILES notation for ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate?
The canonical SMILES for ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate is CCOC(=O)C1CN(C)CC(C)C1=O.
What is the InChIKey of ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate?
The InChIKey is OUNDNHXKTOGOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-4-14-10(13)8-6-11(3)5-7(2)9(8)12/h7-8H,4-6H2,1-3H3.
What are the key properties of ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate?
ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,5-dimethyl-4-oxopiperidine-3-carboxylate is sourced from PubChem (CID 51358492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).