About [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate
[(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate (PubChem CID 51358814) has the molecular formula C14H21NO5
and a molecular weight of 283.32 g/mol. Its IUPAC name is [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate.
Molecular Properties
| Compound Name | [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate |
| PubChem CID | 51358814 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)O[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21NO5/c1-9(16)7-12(17)19-11-6-5-10(8-11)15-13(18)20-14(2,3)4/h5-6,10-11H,7-8H2,1-4H3,(H,15,18)/t10-,11+/m0/s1 |
| InChIKey | LBRBGBSYXYQRLR-WDEREUQCSA-N |
| XLogP | 1.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate?
The IUPAC name of [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate (CID 51358814) is [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate.
What is the SMILES notation for [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate?
The canonical SMILES for [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate is CC(=O)CC(=O)O[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1.
What is the InChIKey of [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate?
The InChIKey is LBRBGBSYXYQRLR-WDEREUQCSA-N. The full InChI is InChI=1S/C14H21NO5/c1-9(16)7-12(17)19-11-6-5-10(8-11)15-13(18)20-14(2,3)4/h5-6,10-11H,7-8H2,1-4H3,(H,15,18)/t10-,11+/m0/s1.
What are the key properties of [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate?
[(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate has a molecular weight of 283.32 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 3-oxobutanoate is sourced from PubChem (CID 51358814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).