C15H20O6 — CID 51358845
(3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methoxyspiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol (PubChem CID 51358845) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methoxyspiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol.
| Compound Name | (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methoxyspiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 51358845 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methoxyspiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
| SMILES | COc1ccc2c(c1)CO[C@@]21O[C@H](CCO)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20O6/c1-19-10-2-3-12-9(6-10)8-20-15(12)14(18)13(17)7-11(21-15)4-5-16/h2-3,6,11,13-14,16-18H,4-5,7-8H2,1H3/t11-,13+,14-,15-/m1/s1 |
| InChIKey | SNRZXMOEZPTGQK-FAAHXZRKSA-N |
| XLogP | 0.27 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |