C33H32N2O5S2 — CID 51359000
(2S,4aR,7S,8aS)-6-(benzenesulfonyl)-1-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 51359000) has the molecular formula C33H32N2O5S2 and a molecular weight of 600.76 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-6-(benzenesulfonyl)-1-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-6-(benzenesulfonyl)-1-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 51359000 |
| Molecular Formula | C33H32N2O5S2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | (2S,4aR,7S,8aS)-6-(benzenesulfonyl)-1-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](c3ccccc3)CC(=O)[C@@H]3CN(S(=O)(=O)c4ccccc4)[C@H](c4ccccc4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C33H32N2O5S2/c1-24-17-19-28(20-18-24)42(39,40)35-31(26-13-7-3-8-14-26)22-33(36)29-23-34(41(37,38)27-15-9-4-10-16-27)30(21-32(29)35)25-11-5-2-6-12-25/h2-20,29-32H,21-23H2,1H3/t29-,30+,31+,32+/m1/s1 |
| InChIKey | QOHFMGDMPSQSBY-ZLESDFJESA-N |
| XLogP | 5.52 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |