About 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine
2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine (PubChem CID 51359064) has the molecular formula C23H21FN2O2
and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine |
| PubChem CID | 51359064 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2nc3ccc(C)cn3c2Cc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C23H21FN2O2/c1-15-7-10-22-25-23(17-8-9-20(27-2)21(13-17)28-3)19(26(22)14-15)12-16-5-4-6-18(24)11-16/h4-11,13-14H,12H2,1-3H3 |
| InChIKey | FWVVJTMRJOVXGB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine (CID 51359064) is 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine is COc1ccc(-c2nc3ccc(C)cn3c2Cc2cccc(F)c2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine?
The InChIKey is FWVVJTMRJOVXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FN2O2/c1-15-7-10-22-25-23(17-8-9-20(27-2)21(13-17)28-3)19(26(22)14-15)12-16-5-4-6-18(24)11-16/h4-11,13-14H,12H2,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine?
2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine has a molecular weight of 376.43 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-3-[(3-fluorophenyl)methyl]-6-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 51359064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).