C24H27NO4S — CID 51359088
ethyl (2S,6S)-1-(4-methylphenyl)sulfonyl-2-phenyl-6-prop-2-enyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 51359088) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is ethyl (2S,6S)-1-(4-methylphenyl)sulfonyl-2-phenyl-6-prop-2-enyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl (2S,6S)-1-(4-methylphenyl)sulfonyl-2-phenyl-6-prop-2-enyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 51359088 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | ethyl (2S,6S)-1-(4-methylphenyl)sulfonyl-2-phenyl-6-prop-2-enyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | C=CC[C@H]1C(C(=O)OCC)=CC[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO4S/c1-4-9-23-21(24(26)29-5-2)16-17-22(19-10-7-6-8-11-19)25(23)30(27,28)20-14-12-18(3)13-15-20/h4,6-8,10-16,22-23H,1,5,9,17H2,2-3H3/t22-,23-/m0/s1 |
| InChIKey | RXWZLJITUXQHEC-GOTSBHOMSA-N |
| XLogP | 4.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|