C25H31NO4S — CID 51359095
ethyl (2S,5R)-1-(4-methylphenyl)sulfonyl-5-pentyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 51359095) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is ethyl (2S,5R)-1-(4-methylphenyl)sulfonyl-5-pentyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl (2S,5R)-1-(4-methylphenyl)sulfonyl-5-pentyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51359095 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethyl (2S,5R)-1-(4-methylphenyl)sulfonyl-5-pentyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCCCC[C@@H]1C=C(C(=O)OCC)[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H31NO4S/c1-4-6-8-13-21-18-23(25(27)30-5-2)24(20-11-9-7-10-12-20)26(21)31(28,29)22-16-14-19(3)15-17-22/h7,9-12,14-18,21,24H,4-6,8,13H2,1-3H3/t21-,24+/m1/s1 |
| InChIKey | XMEDMZJUCUKGEH-QPPBQGQZSA-N |
| XLogP | 5.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|