C25H28N2O6S — CID 51359195
ethyl (2S,5R)-5-cyclohexyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 51359195) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is ethyl (2S,5R)-5-cyclohexyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl (2S,5R)-5-cyclohexyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51359195 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | ethyl (2S,5R)-5-cyclohexyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](C2CCCCC2)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H28N2O6S/c1-2-33-25(28)22-17-23(18-9-5-3-6-10-18)26(24(22)19-11-7-4-8-12-19)34(31,32)21-15-13-20(14-16-21)27(29)30/h4,7-8,11-18,23-24H,2-3,5-6,9-10H2,1H3/t23-,24-/m0/s1 |
| InChIKey | LHCBSTHQLLODDR-ZEQRLZLVSA-N |
| XLogP | 4.78 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|