C21H22N2O6S — CID 51359196
ethyl (2S,5R)-5-ethyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 51359196) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is ethyl (2S,5R)-5-ethyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl (2S,5R)-5-ethyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51359196 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | ethyl (2S,5R)-5-ethyl-1-(4-nitrophenyl)sulfonyl-2-phenyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](CC)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22N2O6S/c1-3-16-14-19(21(24)29-4-2)20(15-8-6-5-7-9-15)22(16)30(27,28)18-12-10-17(11-13-18)23(25)26/h5-14,16,20H,3-4H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | JFLBMAPGSKNWOW-UZLBHIALSA-N |
| XLogP | 3.61 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|