C33H34N2O5S — CID 51359250
(3aS,5aR,6R,8aR,8bR)-2-cyclohexyl-7-(4-methylphenyl)sulfonyl-6-naphthalen-1-yl-4,5a,6,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-e]isoindole-1,3,5-trione (PubChem CID 51359250) has the molecular formula C33H34N2O5S and a molecular weight of 570.71 g/mol. Its IUPAC name is (3aS,5aR,6R,8aR,8bR)-2-cyclohexyl-7-(4-methylphenyl)sulfonyl-6-naphthalen-1-yl-4,5a,6,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-e]isoindole-1,3,5-trione.
| Compound Name | (3aS,5aR,6R,8aR,8bR)-2-cyclohexyl-7-(4-methylphenyl)sulfonyl-6-naphthalen-1-yl-4,5a,6,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-e]isoindole-1,3,5-trione |
|---|---|
| PubChem CID | 51359250 |
| Molecular Formula | C33H34N2O5S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (3aS,5aR,6R,8aR,8bR)-2-cyclohexyl-7-(4-methylphenyl)sulfonyl-6-naphthalen-1-yl-4,5a,6,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-e]isoindole-1,3,5-trione |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3[C@H]4C(=O)N(C5CCCCC5)C(=O)[C@H]4CC(=O)[C@H]3[C@@H]2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H34N2O5S/c1-20-14-16-23(17-15-20)41(39,40)34-19-27-29-26(32(37)35(33(29)38)22-10-3-2-4-11-22)18-28(36)30(27)31(34)25-13-7-9-21-8-5-6-12-24(21)25/h5-9,12-17,22,26-27,29-31H,2-4,10-11,18-19H2,1H3/t26-,27-,29-,30-,31-/m0/s1 |
| InChIKey | XWHNSJZIPGSKFG-ZZPXSOBZSA-N |
| XLogP | 5.03 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|