C28H30N2O5S2 — CID 51359269
(2S,4aR,8aS)-1,6-bis-(4-methylphenyl)sulfonyl-2-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 51359269) has the molecular formula C28H30N2O5S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is (2S,4aR,8aS)-1,6-bis-(4-methylphenyl)sulfonyl-2-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,8aS)-1,6-bis-(4-methylphenyl)sulfonyl-2-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 51359269 |
| Molecular Formula | C28H30N2O5S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (2S,4aR,8aS)-1,6-bis-(4-methylphenyl)sulfonyl-2-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3[C@@H](C2)C(=O)C[C@@H](c2ccccc2)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H30N2O5S2/c1-20-8-12-23(13-9-20)36(32,33)29-17-16-26-25(19-29)28(31)18-27(22-6-4-3-5-7-22)30(26)37(34,35)24-14-10-21(2)11-15-24/h3-15,25-27H,16-19H2,1-2H3/t25-,26+,27+/m1/s1 |
| InChIKey | IECLISPVMCZTRB-PVHODMMVSA-N |
| XLogP | 4.09 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |