C35H36N2O5S2 — CID 51359281
(2S,4aR,7S,8aS)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-7-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 51359281) has the molecular formula C35H36N2O5S2 and a molecular weight of 628.82 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-7-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-7-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 51359281 |
| Molecular Formula | C35H36N2O5S2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (2S,4aR,7S,8aS)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-7-phenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc([C@@H]2CC(=O)[C@@H]3CN(S(=O)(=O)c4ccc(C)cc4)[C@H](c4ccccc4)C[C@@H]3N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H36N2O5S2/c1-24-9-15-28(16-10-24)33-22-35(38)31-23-36(43(39,40)29-17-11-25(2)12-18-29)32(27-7-5-4-6-8-27)21-34(31)37(33)44(41,42)30-19-13-26(3)14-20-30/h4-20,31-34H,21-23H2,1-3H3/t31-,32+,33+,34+/m1/s1 |
| InChIKey | IUDGPJPMYFQRGO-WNQXLSPZSA-N |
| XLogP | 6.14 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |