C35H35FN2O5S2 — CID 51359285
(2S,4aR,7S,8aS)-2-(2-fluorophenyl)-7-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 51359285) has the molecular formula C35H35FN2O5S2 and a molecular weight of 646.81 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-2-(2-fluorophenyl)-7-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-2-(2-fluorophenyl)-7-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 51359285 |
| Molecular Formula | C35H35FN2O5S2 |
| Molecular Weight | 646.81 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | (2S,4aR,7S,8aS)-2-(2-fluorophenyl)-7-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc([C@@H]2C[C@H]3[C@@H](CN2S(=O)(=O)c2ccc(C)cc2)C(=O)C[C@@H](c2ccccc2F)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H35FN2O5S2/c1-23-8-14-26(15-9-23)32-20-33-30(22-37(32)44(40,41)27-16-10-24(2)11-17-27)35(39)21-34(29-6-4-5-7-31(29)36)38(33)45(42,43)28-18-12-25(3)13-19-28/h4-19,30,32-34H,20-22H2,1-3H3/t30-,32+,33+,34+/m1/s1 |
| InChIKey | MEYMNCLRBOZUTL-ZQTBNDFDSA-N |
| XLogP | 6.28 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.81 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |