C27H35NO5S — CID 51359517
4-(butoxymethyl)-9-(4-tert-butyl-3-methylphenoxy)-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 51359517) has the molecular formula C27H35NO5S and a molecular weight of 485.65 g/mol. Its IUPAC name is 4-(butoxymethyl)-9-(4-tert-butyl-3-methylphenoxy)-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 4-(butoxymethyl)-9-(4-tert-butyl-3-methylphenoxy)-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 51359517 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 4-(butoxymethyl)-9-(4-tert-butyl-3-methylphenoxy)-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | C#CCN1CC(COCCCC)Oc2cccc(Oc3ccc(C(C)(C)C)c(C)c3)c2S1(=O)=O |
| InChI | InChI=1S/C27H35NO5S/c1-7-9-16-31-19-22-18-28(15-8-2)34(29,30)26-24(11-10-12-25(26)33-22)32-21-13-14-23(20(3)17-21)27(4,5)6/h2,10-14,17,22H,7,9,15-16,18-19H2,1,3-6H3 |
| InChIKey | BGOIZRFAPVLLNA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|