C24H33NO5S — CID 51359558
4-(butoxymethyl)-2-butyl-9-(4-methylphenoxy)-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 51359558) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is 4-(butoxymethyl)-2-butyl-9-(4-methylphenoxy)-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 4-(butoxymethyl)-2-butyl-9-(4-methylphenoxy)-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 51359558 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-(butoxymethyl)-2-butyl-9-(4-methylphenoxy)-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | CCCCOCC1CN(CCCC)S(=O)(=O)c2c(Oc3ccc(C)cc3)cccc2O1 |
| InChI | InChI=1S/C24H33NO5S/c1-4-6-15-25-17-21(18-28-16-7-5-2)30-23-10-8-9-22(24(23)31(25,26)27)29-20-13-11-19(3)12-14-20/h8-14,21H,4-7,15-18H2,1-3H3 |
| InChIKey | RGRJCQDBVMKSFM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|