C14H16N2O4S2 — CID 51359595
(5aR,8S)-8-benzyl-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione (PubChem CID 51359595) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (5aR,8S)-8-benzyl-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione.
| Compound Name | (5aR,8S)-8-benzyl-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
|---|---|
| PubChem CID | 51359595 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (5aR,8S)-8-benzyl-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2[C@H]1CSCCS2(=O)=O |
| InChI | InChI=1S/C14H16N2O4S2/c17-13-12-9-21-6-7-22(19,20)16(12)14(18)11(15-13)8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | LSQBLCFHYLNWJY-RYUDHWBXSA-N |
| XLogP | 0.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |