C17H26FNO4S — CID 51359624
4-(butoxymethyl)-2-butyl-9-fluoro-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 51359624) has the molecular formula C17H26FNO4S and a molecular weight of 359.46 g/mol. Its IUPAC name is 4-(butoxymethyl)-2-butyl-9-fluoro-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 4-(butoxymethyl)-2-butyl-9-fluoro-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 51359624 |
| Molecular Formula | C17H26FNO4S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-(butoxymethyl)-2-butyl-9-fluoro-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | CCCCOCC1CN(CCCC)S(=O)(=O)c2c(F)cccc2O1 |
| InChI | InChI=1S/C17H26FNO4S/c1-3-5-10-19-12-14(13-22-11-6-4-2)23-16-9-7-8-15(18)17(16)24(19,20)21/h7-9,14H,3-6,10-13H2,1-2H3 |
| InChIKey | LSYJQCBBXGHNBC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|