C16H20FNO4S — CID 51359626
4-(butoxymethyl)-9-fluoro-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 51359626) has the molecular formula C16H20FNO4S and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-(butoxymethyl)-9-fluoro-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 4-(butoxymethyl)-9-fluoro-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 51359626 |
| Molecular Formula | C16H20FNO4S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-(butoxymethyl)-9-fluoro-2-prop-2-ynyl-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | C#CCN1CC(COCCCC)Oc2cccc(F)c2S1(=O)=O |
| InChI | InChI=1S/C16H20FNO4S/c1-3-5-10-21-12-13-11-18(9-4-2)23(19,20)16-14(17)7-6-8-15(16)22-13/h2,6-8,13H,3,5,9-12H2,1H3 |
| InChIKey | DNNYIMBJLOXRDM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|