C17H16N2O3S — CID 51359667
4-benzyl-1,1-dioxo-2-prop-2-enyl-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 51359667) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-benzyl-1,1-dioxo-2-prop-2-enyl-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 4-benzyl-1,1-dioxo-2-prop-2-enyl-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 51359667 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-benzyl-1,1-dioxo-2-prop-2-enyl-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | C=CCN1C(=O)N(Cc2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H16N2O3S/c1-2-12-19-17(20)18(13-14-8-4-3-5-9-14)15-10-6-7-11-16(15)23(19,21)22/h2-11H,1,12-13H2 |
| InChIKey | FRAUEHZLRCMOSX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|