About 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide
2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 51359872) has the molecular formula C22H28N2O2S
and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 51359872 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CC(N2CCC(Cc3ccccc3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O2S/c25-27(26)18-22(17-24(27)16-21-9-5-2-6-10-21)23-13-11-20(12-14-23)15-19-7-3-1-4-8-19/h1-10,20,22H,11-18H2 |
| InChIKey | CXCFLKGKADZHEG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide (CID 51359872) is 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide is O=S1(=O)CC(N2CCC(Cc3ccccc3)CC2)CN1Cc1ccccc1.
What is the InChIKey of 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The InChIKey is CXCFLKGKADZHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O2S/c25-27(26)18-22(17-24(27)16-21-9-5-2-6-10-21)23-13-11-20(12-14-23)15-19-7-3-1-4-8-19/h1-10,20,22H,11-18H2.
What are the key properties of 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide?
2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide has a molecular weight of 384.54 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(4-benzylpiperidin-1-yl)-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 51359872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).